CAS 1185308-93-3 is the registry number for 3–Fluoro–5–(ethoxy–d5)–bromobenzene. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
1-bromo-3-fluoro-5-(1,1,2,2,2-pentadeuterioethoxy)benzene (CAS 1185308-93-3) is a chemical compound with the molecular formula C8H8BrFO and a molecular weight of 224.08 g/mol. IUPAC name: 1-bromo-3-fluoro-5-(1,1,2,2,2-pentadeuterioethoxy)benzene. InChIKey: SQLIBVAWDBGNHE-ZBJDZAJPSA-N.
| Molecular formula | C8H8BrFO |
|---|---|
| Molecular weight | 224.08 g/mol |
| IUPAC name | 1-bromo-3-fluoro-5-(1,1,2,2,2-pentadeuterioethoxy)benzene |
| InChIKey | SQLIBVAWDBGNHE-ZBJDZAJPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])OC1=CC(=CC(=C1)Br)F |
Computed by PubChem (NCBI)