CAS 1185312-11-1 is the registry number for 4–iso–Propylbromo(benzene–d4). Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
1-bromo-2,3,5,6-tetradeuterio-4-propan-2-ylbenzene (CAS 1185312-11-1) is a chemical compound with the molecular formula C9H11Br and a molecular weight of 203.11 g/mol. IUPAC name: 1-bromo-2,3,5,6-tetradeuterio-4-propan-2-ylbenzene. InChIKey: MOZHUOIQYVYEPN-LNFUJOGGSA-N.
| Molecular formula | C9H11Br |
|---|---|
| Molecular weight | 203.11 g/mol |
| IUPAC name | 1-bromo-2,3,5,6-tetradeuterio-4-propan-2-ylbenzene |
| InChIKey | MOZHUOIQYVYEPN-LNFUJOGGSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C(C)C)[2H])[2H])Br)[2H] |
Computed by PubChem (NCBI)