CAS 1185314-24-2 is the registry number for 4–(iso–Propyl–d7)bromobenzene. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
1-bromo-4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)benzene (CAS 1185314-24-2) is a chemical compound with the molecular formula C9H11Br and a molecular weight of 206.13 g/mol. IUPAC name: 1-bromo-4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)benzene. InChIKey: MOZHUOIQYVYEPN-QXMYYZBZSA-N.
| Molecular formula | C9H11Br |
|---|---|
| Molecular weight | 206.13 g/mol |
| IUPAC name | 1-bromo-4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)benzene |
| InChIKey | MOZHUOIQYVYEPN-QXMYYZBZSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C1=CC=C(C=C1)Br)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)