Products 1185312-74-6
CAS 1185312-74-6 is the registry number for 2–Chloro–6–(iso–propyl–d7)–4–aminopyridine. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
2-chloro-6-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)pyridin-4-amine (CAS 1185312-74-6) is a chemical compound with the molecular formula C8H11ClN2 and a molecular weight of 177.68 g/mol. IUPAC name: 2-chloro-6-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)pyridin-4-amine. InChIKey: DYZXEUVRAFUKSD-TXVPSQRDSA-N.
| Molecular formula | C8H11ClN2 |
|---|---|
| Molecular weight | 177.68 g/mol |
| IUPAC name | 2-chloro-6-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)pyridin-4-amine |
| InChIKey | DYZXEUVRAFUKSD-TXVPSQRDSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C1=NC(=CC(=C1)N)Cl)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)