CAS 1185316-03-3 appears in our catalog under these names: 2-Hydroxy-4-methylpyridine-d3, 2–Hydroxy–4–(methyl–d3)–pyridine. Offered by: TRC, GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
4-(trideuteriomethyl)-1H-pyridin-2-one (CAS 1185316-03-3) is a chemical compound with the molecular formula C6H7NO and a molecular weight of 112.14 g/mol. IUPAC name: 4-(trideuteriomethyl)-1H-pyridin-2-one. InChIKey: YBDRFJXGJQULGH-FIBGUPNXSA-N.
| Molecular formula | C6H7NO |
|---|---|
| Molecular weight | 112.14 g/mol |
| IUPAC name | 4-(trideuteriomethyl)-1H-pyridin-2-one |
| InChIKey | YBDRFJXGJQULGH-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=CC(=O)NC=C1 |
Computed by PubChem (NCBI)