Products 916979-13-0
CAS 916979-13-0 is the registry number for 2-Hydroxy-4-methylpyridine-d6. Offered by: TRC. Available pack sizes: 25mg.
3,5,6-trideuterio-4-(trideuteriomethyl)-1H-pyridin-2-one (CAS 916979-13-0) is a chemical compound with the molecular formula C6H7NO and a molecular weight of 115.16 g/mol. IUPAC name: 3,5,6-trideuterio-4-(trideuteriomethyl)-1H-pyridin-2-one. InChIKey: YBDRFJXGJQULGH-RLTMCGQMSA-N.
| Molecular formula | C6H7NO |
|---|---|
| Molecular weight | 115.16 g/mol |
| IUPAC name | 3,5,6-trideuterio-4-(trideuteriomethyl)-1H-pyridin-2-one |
| InChIKey | YBDRFJXGJQULGH-RLTMCGQMSA-N |
| SMILES | [2H]C1=C(NC(=O)C(=C1C([2H])([2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)