CAS 1185316-58-8 is the registry number for 4,6–Dichloro–2–(methoxy–d3)–pyrimidine. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
4,6-dichloro-2-(trideuteriomethoxy)pyrimidine (CAS 1185316-58-8) is a chemical compound with the molecular formula C5H4Cl2N2O and a molecular weight of 182.02 g/mol. IUPAC name: 4,6-dichloro-2-(trideuteriomethoxy)pyrimidine. InChIKey: WDELVDLDINRUQF-FIBGUPNXSA-N.
| Molecular formula | C5H4Cl2N2O |
|---|---|
| Molecular weight | 182.02 g/mol |
| IUPAC name | 4,6-dichloro-2-(trideuteriomethoxy)pyrimidine |
| InChIKey | WDELVDLDINRUQF-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC1=NC(=CC(=N1)Cl)Cl |
Computed by PubChem (NCBI)