CAS 1185364-37-7 is the registry number for 3-Piperidinyl(2-thienyl)methanone hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
Piperidin-3-yl(thiophen-2-yl)methanone;hydrochloride (CAS 1185364-37-7) is a chemical compound with the molecular formula C10H14ClNOS and a molecular weight of 231.74 g/mol. IUPAC name: piperidin-3-yl(thiophen-2-yl)methanone;hydrochloride. InChIKey: RKLBRCSQKBOMGN-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNOS |
|---|---|
| Molecular weight | 231.74 g/mol |
| IUPAC name | piperidin-3-yl(thiophen-2-yl)methanone;hydrochloride |
| InChIKey | RKLBRCSQKBOMGN-UHFFFAOYSA-N |
| SMILES | C1CC(CNC1)C(=O)C2=CC=CS2.Cl |
Computed by PubChem (NCBI)