CAS 1376266-52-2 appears in our catalog under these names: 2-(Pyrrolidin-2-yl)-1-(thiophen-2-yl)ethan-1-one hydrochloride, 2-(Pyrrolidin-2-yl)-1-(thiophen-2-yl)ethan-1-one hydrochloride, 98%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 1g.
2-pyrrolidin-2-yl-1-thiophen-2-ylethanone;hydrochloride (CAS 1376266-52-2) is a chemical compound with the molecular formula C10H14ClNOS and a molecular weight of 231.74 g/mol. IUPAC name: 2-pyrrolidin-2-yl-1-thiophen-2-ylethanone;hydrochloride. InChIKey: YZIFENKIBYVSJI-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNOS |
|---|---|
| Molecular weight | 231.74 g/mol |
| IUPAC name | 2-pyrrolidin-2-yl-1-thiophen-2-ylethanone;hydrochloride |
| InChIKey | YZIFENKIBYVSJI-UHFFFAOYSA-N |
| SMILES | C1CC(NC1)CC(=O)C2=CC=CS2.Cl |
Computed by PubChem (NCBI)