CAS 118537-45-4 is the registry number for Methyl (S)-2-amino-5-(1,3-dioxoisoindolin-2-yl)pentanoate hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2S)-2-amino-5-(1,3-dioxoisoindol-2-yl)pentanoate;hydrochloride (CAS 118537-45-4) is a chemical compound with the molecular formula C14H17ClN2O4 and a molecular weight of 312.75 g/mol. IUPAC name: methyl (2S)-2-amino-5-(1,3-dioxoisoindol-2-yl)pentanoate;hydrochloride. InChIKey: GLFBFRCSQVTOCR-MERQFXBCSA-N.
| Molecular formula | C14H17ClN2O4 |
|---|---|
| Molecular weight | 312.75 g/mol |
| IUPAC name | methyl (2S)-2-amino-5-(1,3-dioxoisoindol-2-yl)pentanoate;hydrochloride |
| InChIKey | GLFBFRCSQVTOCR-MERQFXBCSA-N |
| SMILES | COC(=O)[C@H](CCCN1C(=O)C2=CC=CC=C2C1=O)N.Cl |
Computed by PubChem (NCBI)