CAS 931395-73-2 appears in our catalog under these names: 5-Chloro-6-[4-(ethoxycarbonyl)piperidino]nicotinic acid, 95%, Avatrombopag Impurity 5, 5-Chloro-6-(4-(ethoxycarbonyl)piperidino)-nicotinic acid, 5-Chloro-6-(4-(ethoxycarbonyl)piperidin-1-yl)nicotinic acid 98%, 5-CHLORO-6-[4-(ETHOXYCARBONYL)PIPERIDINO]NICOTINIC ACID, 98%, 98%. Offered by: Combi-blocks, Chemat Brand, TRC, Ambeed, Chemat. Available pack sizes: 1g, 5g, on request, 10g, 250mg, 25g.
5-chloro-6-(4-ethoxycarbonylpiperidin-1-yl)pyridine-3-carboxylic acid (CAS 931395-73-2) is a chemical compound with the molecular formula C14H17ClN2O4 and a molecular weight of 312.75 g/mol. IUPAC name: 5-chloro-6-(4-ethoxycarbonylpiperidin-1-yl)pyridine-3-carboxylic acid. InChIKey: JEMRGZNDPCCZNF-UHFFFAOYSA-N.
| Molecular formula | C14H17ClN2O4 |
|---|---|
| Molecular weight | 312.75 g/mol |
| IUPAC name | 5-chloro-6-(4-ethoxycarbonylpiperidin-1-yl)pyridine-3-carboxylic acid |
| InChIKey | JEMRGZNDPCCZNF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CCN(CC1)C2=C(C=C(C=N2)C(=O)O)Cl |
Computed by PubChem (NCBI)