Products 1185426-22-5

CAS 1185426-22-5 is the registry number for 3,4-Diethyl-5-isoxazolamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

3,4-diethyl-1,2-oxazol-5-amine;hydrochloride (CAS 1185426-22-5) is a chemical compound with the molecular formula C7H13ClN2O and a molecular weight of 176.64 g/mol. IUPAC name: 3,4-diethyl-1,2-oxazol-5-amine;hydrochloride. InChIKey: VSOCAVLPLXTFDK-UHFFFAOYSA-N.

Identity
Molecular formulaC7H13ClN2O
Molecular weight176.64 g/mol
IUPAC name3,4-diethyl-1,2-oxazol-5-amine;hydrochloride
InChIKeyVSOCAVLPLXTFDK-UHFFFAOYSA-N
SMILESCCC1=C(ON=C1CC)N.Cl

Computed by PubChem (NCBI)