CAS 1980007-32-6 is the registry number for Cis-6-amino-cyclohex-3-enecarboxylic acid amide hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(1R,6S)-6-aminocyclohex-3-ene-1-carboxamide;hydrochloride (CAS 1980007-32-6) is a chemical compound with the molecular formula C7H13ClN2O and a molecular weight of 176.64 g/mol. IUPAC name: (1R,6S)-6-aminocyclohex-3-ene-1-carboxamide;hydrochloride. InChIKey: DITFOZGDBRLNER-IBTYICNHSA-N.
| Molecular formula | C7H13ClN2O |
|---|---|
| Molecular weight | 176.64 g/mol |
| IUPAC name | (1R,6S)-6-aminocyclohex-3-ene-1-carboxamide;hydrochloride |
| InChIKey | DITFOZGDBRLNER-IBTYICNHSA-N |
| SMILES | C1C=CC[C@@H]([C@@H]1C(=O)N)N.Cl |
Computed by PubChem (NCBI)