Products 1185483-92-4
CAS 1185483-92-4 is the registry number for 3-((4-Bromo-1H-pyrazol-1-yl)methyl)aniline hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3-[(4-bromopyrazol-1-yl)methyl]aniline;hydrochloride (CAS 1185483-92-4) is a chemical compound with the molecular formula C10H11BrClN3 and a molecular weight of 288.57 g/mol. IUPAC name: 3-[(4-bromopyrazol-1-yl)methyl]aniline;hydrochloride. InChIKey: BTDGUVGTIQHESJ-UHFFFAOYSA-N.
| Molecular formula | C10H11BrClN3 |
|---|---|
| Molecular weight | 288.57 g/mol |
| IUPAC name | 3-[(4-bromopyrazol-1-yl)methyl]aniline;hydrochloride |
| InChIKey | BTDGUVGTIQHESJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)CN2C=C(C=N2)Br.Cl |
Computed by PubChem (NCBI)