CAS 2411634-60-9 is the registry number for 6-Bromo-N,N-dimethylquinazolin-2-amine hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 1g.
6-bromo-N,N-dimethylquinazolin-2-amine;hydrochloride (CAS 2411634-60-9) is a chemical compound with the molecular formula C10H11BrClN3 and a molecular weight of 288.57 g/mol. IUPAC name: 6-bromo-N,N-dimethylquinazolin-2-amine;hydrochloride. InChIKey: RIRYPTQDQBZYPR-UHFFFAOYSA-N.
| Molecular formula | C10H11BrClN3 |
|---|---|
| Molecular weight | 288.57 g/mol |
| IUPAC name | 6-bromo-N,N-dimethylquinazolin-2-amine;hydrochloride |
| InChIKey | RIRYPTQDQBZYPR-UHFFFAOYSA-N |
| SMILES | CN(C)C1=NC=C2C=C(C=CC2=N1)Br.Cl |
Computed by PubChem (NCBI)