CAS 1185486-21-8 appears in our catalog under these names: 2-(3-Piperidinyl)-1,3-benzoxazole trifluoroacetate, 95%, 2-(Piperidin-3-yl)benzo[d]oxazole 2,2,2-trifluoroacetate. Offered by: Combi-blocks, Chemat. Available pack sizes: 25g, 10g, 1g, 5g.
2-piperidin-3-yl-1,3-benzoxazole;2,2,2-trifluoroacetic acid (CAS 1185486-21-8) is a chemical compound with the molecular formula C14H15F3N2O3 and a molecular weight of 316.28 g/mol. IUPAC name: 2-piperidin-3-yl-1,3-benzoxazole;2,2,2-trifluoroacetic acid. InChIKey: JLKQJMZMNUFITE-UHFFFAOYSA-N.
| Molecular formula | C14H15F3N2O3 |
|---|---|
| Molecular weight | 316.28 g/mol |
| IUPAC name | 2-piperidin-3-yl-1,3-benzoxazole;2,2,2-trifluoroacetic acid |
| InChIKey | JLKQJMZMNUFITE-UHFFFAOYSA-N |
| SMILES | C1CC(CNC1)C2=NC3=CC=CC=C3O2.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)