Products 1422465-93-7
CAS 1422465-93-7 is the registry number for 4-Acetyl-2-methyl-N-(2-oxo-2-((2,2,2-trifluoroethyl)amino)ethyl)benzamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-acetyl-2-methyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]benzamide (CAS 1422465-93-7) is a chemical compound with the molecular formula C14H15F3N2O3 and a molecular weight of 316.28 g/mol. IUPAC name: 4-acetyl-2-methyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]benzamide. InChIKey: GMTVFAMIADEVIX-UHFFFAOYSA-N.
| Molecular formula | C14H15F3N2O3 |
|---|---|
| Molecular weight | 316.28 g/mol |
| IUPAC name | 4-acetyl-2-methyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]benzamide |
| InChIKey | GMTVFAMIADEVIX-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(=O)C)C(=O)NCC(=O)NCC(F)(F)F |
Computed by PubChem (NCBI)