Products 1185583-20-3
CAS 1185583-20-3 appears in our catalog under these names: Tripeptide-32, Tripeptide–32, Tripeptide-32, 99.95%. Offered by: TargetMol, GLPBio, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 50 mg, 25 mg, 100 mg, 10 mg.
(2S)-1-[(2S,3R)-2-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-3-hydroxybutanoyl]pyrrolidine-2-carboxamide (CAS 1185583-20-3) is a chemical compound with the molecular formula C12H22N4O5 and a molecular weight of 302.33 g/mol. IUPAC name: (2S)-1-[(2S,3R)-2-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-3-hydroxybutanoyl]pyrrolidine-2-carboxamide. InChIKey: FUYMMLFZSQBBKU-XGEHTFHBSA-N.
| Molecular formula | C12H22N4O5 |
|---|---|
| Molecular weight | 302.33 g/mol |
| IUPAC name | (2S)-1-[(2S,3R)-2-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-3-hydroxybutanoyl]pyrrolidine-2-carboxamide |
| InChIKey | FUYMMLFZSQBBKU-XGEHTFHBSA-N |
| SMILES | C[C@H]([C@@H](C(=O)N1CCC[C@H]1C(=O)N)NC(=O)[C@H](CO)N)O |
Computed by PubChem (NCBI)