Products 926-78-3
CAS 926-78-3 appears in our catalog under these names: H–D–Ala–D–Ala–D–Ala–D–Ala–OH, H-D-Ala-D-Ala-D-Ala-D-Ala-OH. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1g, 250mg, 500mg, 1000mg, Get quote.
(2R)-2-[[(2R)-2-[[(2R)-2-[[(2R)-2-aminopropanoyl]amino]propanoyl]amino]propanoyl]amino]propanoic acid (CAS 926-78-3) is a chemical compound with the molecular formula C12H22N4O5 and a molecular weight of 302.33 g/mol. IUPAC name: (2R)-2-[[(2R)-2-[[(2R)-2-[[(2R)-2-aminopropanoyl]amino]propanoyl]amino]propanoyl]amino]propanoic acid. InChIKey: ZHRZLXZJVUFLNY-WCTZXXKLSA-N.
| Molecular formula | C12H22N4O5 |
|---|---|
| Molecular weight | 302.33 g/mol |
| IUPAC name | (2R)-2-[[(2R)-2-[[(2R)-2-[[(2R)-2-aminopropanoyl]amino]propanoyl]amino]propanoyl]amino]propanoic acid |
| InChIKey | ZHRZLXZJVUFLNY-WCTZXXKLSA-N |
| SMILES | C[C@H](C(=O)N[C@H](C)C(=O)N[C@H](C)C(=O)N[C@H](C)C(=O)O)N |
Computed by PubChem (NCBI)