CAS 1185699-01-7 appears in our catalog under these names: 2-Amino-1-(3-pyridinyl)ethanol formate, 95%, 2-Amino-1-(pyridin-3-yl)ethyl formate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.
2-amino-1-pyridin-3-ylethanol;formic acid (CAS 1185699-01-7) is a chemical compound with the molecular formula C8H12N2O3 and a molecular weight of 184.19 g/mol. IUPAC name: 2-amino-1-pyridin-3-ylethanol;formic acid. InChIKey: TZIVKZXNEGLAOR-UHFFFAOYSA-N.
| Molecular formula | C8H12N2O3 |
|---|---|
| Molecular weight | 184.19 g/mol |
| IUPAC name | 2-amino-1-pyridin-3-ylethanol;formic acid |
| InChIKey | TZIVKZXNEGLAOR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C(CN)O.C(=O)O |
Computed by PubChem (NCBI)