CAS 1223452-45-6 appears in our catalog under these names: 3,5-Dimethyl-isoxazole-4-carboxylic acid methoxy-methyl-amide, 95%, N-Methoxy-N,3,5-trimethylisoxazole-4-carboxamide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
N-methoxy-N,3,5-trimethyl-1,2-oxazole-4-carboxamide (CAS 1223452-45-6) is a chemical compound with the molecular formula C8H12N2O3 and a molecular weight of 184.19 g/mol. IUPAC name: N-methoxy-N,3,5-trimethyl-1,2-oxazole-4-carboxamide. InChIKey: KDTAZFGYSUJHGA-UHFFFAOYSA-N.
| Molecular formula | C8H12N2O3 |
|---|---|
| Molecular weight | 184.19 g/mol |
| IUPAC name | N-methoxy-N,3,5-trimethyl-1,2-oxazole-4-carboxamide |
| InChIKey | KDTAZFGYSUJHGA-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C)C(=O)N(C)OC |
Computed by PubChem (NCBI)