CAS 1185712-25-7 is the registry number for 1-(2-Aminoethyl)-4,6-dimethyl-2(1h)-pyrimidinone dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 50g, 1g, 5g.
1-(2-aminoethyl)-4,6-dimethylpyrimidin-2-one;dihydrochloride (CAS 1185712-25-7) is a chemical compound with the molecular formula C8H15Cl2N3O and a molecular weight of 240.13 g/mol. IUPAC name: 1-(2-aminoethyl)-4,6-dimethylpyrimidin-2-one;dihydrochloride. InChIKey: QCKGCBBKLHFRJX-UHFFFAOYSA-N.
| Molecular formula | C8H15Cl2N3O |
|---|---|
| Molecular weight | 240.13 g/mol |
| IUPAC name | 1-(2-aminoethyl)-4,6-dimethylpyrimidin-2-one;dihydrochloride |
| InChIKey | QCKGCBBKLHFRJX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=O)N1CCN)C.Cl.Cl |
Computed by PubChem (NCBI)