CAS 1269054-82-1 appears in our catalog under these names: 2-Methyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one dihydrochloride, 95%, 2–methyl–1,3,8–triazaspiro(4·5)dec–1–en–4–one dihydrochloride. Offered by: Combi-blocks, GLPBio. Available pack sizes: 10g, 5g, 1g, 250mg.
2-methyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one;dihydrochloride (CAS 1269054-82-1) is a chemical compound with the molecular formula C8H15Cl2N3O and a molecular weight of 240.13 g/mol. IUPAC name: 2-methyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one;dihydrochloride. InChIKey: HWIOFUXFIIGUJH-UHFFFAOYSA-N.
| Molecular formula | C8H15Cl2N3O |
|---|---|
| Molecular weight | 240.13 g/mol |
| IUPAC name | 2-methyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one;dihydrochloride |
| InChIKey | HWIOFUXFIIGUJH-UHFFFAOYSA-N |
| SMILES | CC1=NC2(CCNCC2)C(=O)N1.Cl.Cl |
Computed by PubChem (NCBI)