CAS 118578-71-5 appears in our catalog under these names: N-(4-Phenylbenzylidene)benzylamine, 98%, N-(4-PHENYLBENZYLIDENE)BENZYLAMINE, >=&, N-(4-Phenylbenzylidene)benzylamine. Offered by: Combi-blocks, Sigma-Aldrich, Chemat. Available pack sizes: 1g, 250mg.
N-benzyl-1-(4-phenylphenyl)methanimine (CAS 118578-71-5) is a chemical compound with the molecular formula C20H17N and a molecular weight of 271.4 g/mol. IUPAC name: N-benzyl-1-(4-phenylphenyl)methanimine. InChIKey: MBJGFVKTDXQEPJ-UHFFFAOYSA-N.
| Molecular formula | C20H17N |
|---|---|
| Molecular weight | 271.4 g/mol |
| IUPAC name | N-benzyl-1-(4-phenylphenyl)methanimine |
| InChIKey | MBJGFVKTDXQEPJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN=CC2=CC=C(C=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)