CAS 62506-88-1 is the registry number for N-Benzhydryl-1-phenylmethanimine, 98%. Offered by: AmBeed. Available pack sizes: 25g.
N-benzhydryl-1-phenylmethanimine (CAS 62506-88-1) is a chemical compound with the molecular formula C20H17N and a molecular weight of 271.4 g/mol. IUPAC name: N-benzhydryl-1-phenylmethanimine. InChIKey: OVAMCIQDVMEHAG-UHFFFAOYSA-N.
| Molecular formula | C20H17N |
|---|---|
| Molecular weight | 271.4 g/mol |
| IUPAC name | N-benzhydryl-1-phenylmethanimine |
| InChIKey | OVAMCIQDVMEHAG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C=NC(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)