CAS 1186194-50-2 appears in our catalog under these names: Diethyl 3,5-dichlorophenyl malonate, 95%, DIETHYL 3,5-DICHLOROPHENYL MALONATE, 97%, 97%, DIETHYL 3,5-DICHLOROPHENYL MALONATE, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 1g, 5g, 250mg, 100mg.
Diethyl 2-(3,5-dichlorophenyl)propanedioate (CAS 1186194-50-2) is a chemical compound with the molecular formula C13H14Cl2O4 and a molecular weight of 305.15 g/mol. IUPAC name: diethyl 2-(3,5-dichlorophenyl)propanedioate. InChIKey: XMEBTNUDNVIYJG-UHFFFAOYSA-N.
| Molecular formula | C13H14Cl2O4 |
|---|---|
| Molecular weight | 305.15 g/mol |
| IUPAC name | diethyl 2-(3,5-dichlorophenyl)propanedioate |
| InChIKey | XMEBTNUDNVIYJG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C1=CC(=CC(=C1)Cl)Cl)C(=O)OCC |
Computed by PubChem (NCBI)