CAS 28751-26-0 is the registry number for Diethyl 2-(3,4-dichlorophenyl)malonate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Diethyl 2-(3,4-dichlorophenyl)propanedioate (CAS 28751-26-0) is a chemical compound with the molecular formula C13H14Cl2O4 and a molecular weight of 305.15 g/mol. IUPAC name: diethyl 2-(3,4-dichlorophenyl)propanedioate. InChIKey: GZSMDWSQPZMQDV-UHFFFAOYSA-N.
| Molecular formula | C13H14Cl2O4 |
|---|---|
| Molecular weight | 305.15 g/mol |
| IUPAC name | diethyl 2-(3,4-dichlorophenyl)propanedioate |
| InChIKey | GZSMDWSQPZMQDV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C1=CC(=C(C=C1)Cl)Cl)C(=O)OCC |
Computed by PubChem (NCBI)