Products 1186195-14-1
CAS 1186195-14-1 appears in our catalog under these names: 2,3-Bis(trifluoromethyl)-pyrazine, 95+%, 2,3-Bis(trifluoromethyl)pyrazine, 97%. Offered by: AmBeed, Fluorochem. Available pack sizes: 10g, 1g, 5g.
2,3-bis(trifluoromethyl)pyrazine (CAS 1186195-14-1) is a chemical compound with the molecular formula C6H2F6N2 and a molecular weight of 216.08 g/mol. IUPAC name: 2,3-bis(trifluoromethyl)pyrazine. InChIKey: ABHLZHRGCQAXEN-UHFFFAOYSA-N.
| Molecular formula | C6H2F6N2 |
|---|---|
| Molecular weight | 216.08 g/mol |
| IUPAC name | 2,3-bis(trifluoromethyl)pyrazine |
| InChIKey | ABHLZHRGCQAXEN-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C(=N1)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)