CAS 1365988-35-7 is the registry number for 2,5-Bis-(Trifluoromethyl)pyrazine, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
2,5-bis(trifluoromethyl)pyrazine (CAS 1365988-35-7) is a chemical compound with the molecular formula C6H2F6N2 and a molecular weight of 216.08 g/mol. IUPAC name: 2,5-bis(trifluoromethyl)pyrazine. InChIKey: DUCHHTWSOPWERT-UHFFFAOYSA-N.
| Molecular formula | C6H2F6N2 |
|---|---|
| Molecular weight | 216.08 g/mol |
| IUPAC name | 2,5-bis(trifluoromethyl)pyrazine |
| InChIKey | DUCHHTWSOPWERT-UHFFFAOYSA-N |
| SMILES | C1=C(N=CC(=N1)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)