CAS 1186334-64-4 appears in our catalog under these names: 7-Fluoro-1h-indazole-4-boronic acid pinacol ester, 95%, 7-Fluoro-1H-indazole-4-boronic acid pinacol ester, 7-Fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole, 97%, 97%, 7-FLUORO-1H-INDAZOLE-4-BORONIC ACID PINACOL ESTER, 97%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 0,5g, 2g, 10g, 100mg, 250mg, 500mg.
7-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole (CAS 1186334-64-4) is a chemical compound with the molecular formula C13H16BFN2O2 and a molecular weight of 262.09 g/mol. IUPAC name: 7-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole. InChIKey: RAQASWRRBFTDND-UHFFFAOYSA-N.
| Molecular formula | C13H16BFN2O2 |
|---|---|
| Molecular weight | 262.09 g/mol |
| IUPAC name | 7-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole |
| InChIKey | RAQASWRRBFTDND-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C=NNC3=C(C=C2)F |
Computed by PubChem (NCBI)