Products 2734745-79-8
CAS 2734745-79-8 is the registry number for 5-Fluoro-1h-indazole-6-boronic acid pinacol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.
5-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole (CAS 2734745-79-8) is a chemical compound with the molecular formula C13H16BFN2O2 and a molecular weight of 262.09 g/mol. IUPAC name: 5-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole. InChIKey: GMVALTDHVJOYCL-UHFFFAOYSA-N.
| Molecular formula | C13H16BFN2O2 |
|---|---|
| Molecular weight | 262.09 g/mol |
| IUPAC name | 5-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole |
| InChIKey | GMVALTDHVJOYCL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2F)C=NN3 |
Computed by PubChem (NCBI)