CAS 1186423-90-4 is the registry number for 2,4-Dichloro-5-methyl-6-(trifluoromethyl)pyrimidine, 98%. Offered by: AmBeed. Available pack sizes: 1g.
2,4-dichloro-5-methyl-6-(trifluoromethyl)pyrimidine (CAS 1186423-90-4) is a chemical compound with the molecular formula C6H3Cl2F3N2 and a molecular weight of 231.00 g/mol. IUPAC name: 2,4-dichloro-5-methyl-6-(trifluoromethyl)pyrimidine. InChIKey: LEYDKCPBGIGXPQ-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2F3N2 |
|---|---|
| Molecular weight | 231.00 g/mol |
| IUPAC name | 2,4-dichloro-5-methyl-6-(trifluoromethyl)pyrimidine |
| InChIKey | LEYDKCPBGIGXPQ-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(N=C1Cl)Cl)C(F)(F)F |
Computed by PubChem (NCBI)