Products 1446182-76-8
CAS 1446182-76-8 appears in our catalog under these names: 3,5-Dichloro-4-(trifluoromethyl)pyridin-2-amine, 95%, 3,5-Dichloro-4-(trifluoromethyl)pyridin-2-amine, 95%, 95%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g.
3,5-dichloro-4-(trifluoromethyl)pyridin-2-amine (CAS 1446182-76-8) is a chemical compound with the molecular formula C6H3Cl2F3N2 and a molecular weight of 231.00 g/mol. IUPAC name: 3,5-dichloro-4-(trifluoromethyl)pyridin-2-amine. InChIKey: GTTFPORLVZBZJB-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2F3N2 |
|---|---|
| Molecular weight | 231.00 g/mol |
| IUPAC name | 3,5-dichloro-4-(trifluoromethyl)pyridin-2-amine |
| InChIKey | GTTFPORLVZBZJB-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=N1)N)Cl)C(F)(F)F)Cl |
Computed by PubChem (NCBI)