CAS 1186434-13-8 is the registry number for 7-(Trifluoromethoxy)-2,3,4,5-tetrahydrobenzo[f][1,4]thiazepine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-(trifluoromethoxy)-2,3,4,5-tetrahydro-1,4-benzothiazepine (CAS 1186434-13-8) is a chemical compound with the molecular formula C10H10F3NOS and a molecular weight of 249.25 g/mol. IUPAC name: 7-(trifluoromethoxy)-2,3,4,5-tetrahydro-1,4-benzothiazepine. InChIKey: ZIFJSRCIEHCOGI-UHFFFAOYSA-N.
| Molecular formula | C10H10F3NOS |
|---|---|
| Molecular weight | 249.25 g/mol |
| IUPAC name | 7-(trifluoromethoxy)-2,3,4,5-tetrahydro-1,4-benzothiazepine |
| InChIKey | ZIFJSRCIEHCOGI-UHFFFAOYSA-N |
| SMILES | C1CSC2=C(CN1)C=C(C=C2)OC(F)(F)F |
Computed by PubChem (NCBI)