CAS 937602-49-8 is the registry number for 2-[4-(Trifluoromethoxy)phenyl]-1,3-thiazolane, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g.
2-[4-(trifluoromethoxy)phenyl]-1,3-thiazolidine (CAS 937602-49-8) is a chemical compound with the molecular formula C10H10F3NOS and a molecular weight of 249.25 g/mol. IUPAC name: 2-[4-(trifluoromethoxy)phenyl]-1,3-thiazolidine. InChIKey: HHPRGKSEVFESNQ-UHFFFAOYSA-N.
| Molecular formula | C10H10F3NOS |
|---|---|
| Molecular weight | 249.25 g/mol |
| IUPAC name | 2-[4-(trifluoromethoxy)phenyl]-1,3-thiazolidine |
| InChIKey | HHPRGKSEVFESNQ-UHFFFAOYSA-N |
| SMILES | C1CSC(N1)C2=CC=C(C=C2)OC(F)(F)F |
Computed by PubChem (NCBI)