Products 1186634-98-9
CAS 1186634-98-9 is the registry number for 1-(3-Cyclopropyl-1h-pyrazole-5-carbonyl)piperidine, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(5-cyclopropyl-1H-pyrazol-3-yl)-piperidin-1-ylmethanone (CAS 1186634-98-9) is a chemical compound with the molecular formula C12H17N3O and a molecular weight of 219.28 g/mol. IUPAC name: (5-cyclopropyl-1H-pyrazol-3-yl)-piperidin-1-ylmethanone. InChIKey: WTZRRIUQKQWQAN-UHFFFAOYSA-N.
| Molecular formula | C12H17N3O |
|---|---|
| Molecular weight | 219.28 g/mol |
| IUPAC name | (5-cyclopropyl-1H-pyrazol-3-yl)-piperidin-1-ylmethanone |
| InChIKey | WTZRRIUQKQWQAN-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C(=O)C2=NNC(=C2)C3CC3 |
Computed by PubChem (NCBI)