CAS 418809-57-1 is the registry number for N'-(2-Cyano-5,5-dimethyl-3-oxocyclohex-1-en-1-yl)-n,n-dimethylimidoformamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
N'-(2-cyano-5,5-dimethyl-3-oxocyclohexen-1-yl)-N,N-dimethylmethanimidamide (CAS 418809-57-1) is a chemical compound with the molecular formula C12H17N3O and a molecular weight of 219.28 g/mol. IUPAC name: N'-(2-cyano-5,5-dimethyl-3-oxocyclohexen-1-yl)-N,N-dimethylmethanimidamide. InChIKey: QXOXJNUXOFVYSX-UHFFFAOYSA-N.
| Molecular formula | C12H17N3O |
|---|---|
| Molecular weight | 219.28 g/mol |
| IUPAC name | N'-(2-cyano-5,5-dimethyl-3-oxocyclohexen-1-yl)-N,N-dimethylmethanimidamide |
| InChIKey | QXOXJNUXOFVYSX-UHFFFAOYSA-N |
| SMILES | CC1(CC(=C(C(=O)C1)C#N)N=CN(C)C)C |
Computed by PubChem (NCBI)