CAS 1186647-71-1 appears in our catalog under these names: 4-Chloro-3-iodo-1-(propan-2-yl)-1h-pyrazolo[4,3-c]pyridine, 95%, 4-chloro-3-iodo-1-(propan-2-yl)-1H-pyrazolo(4,3-c)pyridine, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 10g, 5g.
4-chloro-3-iodo-1-propan-2-ylpyrazolo[4,3-c]pyridine (CAS 1186647-71-1) is a chemical compound with the molecular formula C9H9ClIN3 and a molecular weight of 321.54 g/mol. IUPAC name: 4-chloro-3-iodo-1-propan-2-ylpyrazolo[4,3-c]pyridine. InChIKey: NUONMXZGVOQRFJ-UHFFFAOYSA-N.
| Molecular formula | C9H9ClIN3 |
|---|---|
| Molecular weight | 321.54 g/mol |
| IUPAC name | 4-chloro-3-iodo-1-propan-2-ylpyrazolo[4,3-c]pyridine |
| InChIKey | NUONMXZGVOQRFJ-UHFFFAOYSA-N |
| SMILES | CC(C)N1C2=C(C(=NC=C2)Cl)C(=N1)I |
Computed by PubChem (NCBI)