CAS 2250242-92-1 is the registry number for 6-Chloro-3-iodo-2-isopropyl-2h-pyrazolo[4,3-c]pyridine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6-chloro-3-iodo-2-propan-2-ylpyrazolo[4,3-c]pyridine (CAS 2250242-92-1) is a chemical compound with the molecular formula C9H9ClIN3 and a molecular weight of 321.54 g/mol. IUPAC name: 6-chloro-3-iodo-2-propan-2-ylpyrazolo[4,3-c]pyridine. InChIKey: FDLVBAZTQIFJSQ-UHFFFAOYSA-N.
| Molecular formula | C9H9ClIN3 |
|---|---|
| Molecular weight | 321.54 g/mol |
| IUPAC name | 6-chloro-3-iodo-2-propan-2-ylpyrazolo[4,3-c]pyridine |
| InChIKey | FDLVBAZTQIFJSQ-UHFFFAOYSA-N |
| SMILES | CC(C)N1C(=C2C=NC(=CC2=N1)Cl)I |
Computed by PubChem (NCBI)