Products 1187056-38-7

CAS 1187056-38-7 is the registry number for Ethyl 2-(2,6-difluorophenyl)thiazole-4-carboxylate. Offered by: Biosynth. Available pack sizes: 100mg, 50mg, 250mg, 1000mg, 500mg.

Structural formula: {0} (CAS {1})

Ethyl 2-(2,6-difluorophenyl)-1,3-thiazole-4-carboxylate (CAS 1187056-38-7) is a chemical compound with the molecular formula C12H9F2NO2S and a molecular weight of 269.27 g/mol. IUPAC name: ethyl 2-(2,6-difluorophenyl)-1,3-thiazole-4-carboxylate. InChIKey: DDPCNNSTYGJTTL-UHFFFAOYSA-N.

Identity
Molecular formulaC12H9F2NO2S
Molecular weight269.27 g/mol
IUPAC nameethyl 2-(2,6-difluorophenyl)-1,3-thiazole-4-carboxylate
InChIKeyDDPCNNSTYGJTTL-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CSC(=N1)C2=C(C=CC=C2F)F

Computed by PubChem (NCBI)