CAS 1550569-16-8 is the registry number for 2-(4-(Difluoromethyl)phenyl)-4-methylthiazole-5-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-[4-(difluoromethyl)phenyl]-4-methyl-1,3-thiazole-5-carboxylic acid (CAS 1550569-16-8) is a chemical compound with the molecular formula C12H9F2NO2S and a molecular weight of 269.27 g/mol. IUPAC name: 2-[4-(difluoromethyl)phenyl]-4-methyl-1,3-thiazole-5-carboxylic acid. InChIKey: BGWYWKWPBBTQOG-UHFFFAOYSA-N.
| Molecular formula | C12H9F2NO2S |
|---|---|
| Molecular weight | 269.27 g/mol |
| IUPAC name | 2-[4-(difluoromethyl)phenyl]-4-methyl-1,3-thiazole-5-carboxylic acid |
| InChIKey | BGWYWKWPBBTQOG-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C2=CC=C(C=C2)C(F)F)C(=O)O |
Computed by PubChem (NCBI)