CAS 1187056-90-1 is the registry number for 3-(3,4-Difluorophenyl)-4-methyl-1H-pyrazol-5-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(3,4-difluorophenyl)-4-methyl-1H-pyrazol-3-amine (CAS 1187056-90-1) is a chemical compound with the molecular formula C10H9F2N3 and a molecular weight of 209.20 g/mol. IUPAC name: 5-(3,4-difluorophenyl)-4-methyl-1H-pyrazol-3-amine. InChIKey: JTDMDXACSIFNMK-UHFFFAOYSA-N.
| Molecular formula | C10H9F2N3 |
|---|---|
| Molecular weight | 209.20 g/mol |
| IUPAC name | 5-(3,4-difluorophenyl)-4-methyl-1H-pyrazol-3-amine |
| InChIKey | JTDMDXACSIFNMK-UHFFFAOYSA-N |
| SMILES | CC1=C(NN=C1N)C2=CC(=C(C=C2)F)F |
Computed by PubChem (NCBI)