CAS 1240578-13-5 is the registry number for 1-[(2,4-Difluorophenyl)methyl]-1h-pyrazol-4-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 5g.
1-[(2,4-difluorophenyl)methyl]pyrazol-4-amine (CAS 1240578-13-5) is a chemical compound with the molecular formula C10H9F2N3 and a molecular weight of 209.20 g/mol. IUPAC name: 1-[(2,4-difluorophenyl)methyl]pyrazol-4-amine. InChIKey: KJUVZIAADOZCEH-UHFFFAOYSA-N.
| Molecular formula | C10H9F2N3 |
|---|---|
| Molecular weight | 209.20 g/mol |
| IUPAC name | 1-[(2,4-difluorophenyl)methyl]pyrazol-4-amine |
| InChIKey | KJUVZIAADOZCEH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)CN2C=C(C=N2)N |
Computed by PubChem (NCBI)