CAS 118708-88-6 is the registry number for 1-(4-Trifluoromethyl-pyridin-2-yl)-piperazine, 97%. Offered by: Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.
1-[4-(trifluoromethyl)-2-pyridinyl]piperazine (CAS 118708-88-6) is a chemical compound with the molecular formula C10H12F3N3 and a molecular weight of 231.22 g/mol. IUPAC name: 1-[4-(trifluoromethyl)-2-pyridinyl]piperazine. InChIKey: GRKRSFCFKGOSNB-UHFFFAOYSA-N.
| Molecular formula | C10H12F3N3 |
|---|---|
| Molecular weight | 231.22 g/mol |
| IUPAC name | 1-[4-(trifluoromethyl)-2-pyridinyl]piperazine |
| InChIKey | GRKRSFCFKGOSNB-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=NC=CC(=C2)C(F)(F)F |
Computed by PubChem (NCBI)