CAS 132834-58-3 appears in our catalog under these names: 1–(5–(TrifluoroMethyl)–2–pyridinyl)piperazine, 1-[5-(Trifluoromethyl)pyrid-2-yl]piperazine, 95%. Offered by: GLPBio, Fluorochem. Available pack sizes: 100g, 25g, 5g, 1g, 500g.
1-[5-(trifluoromethyl)-2-pyridinyl]piperazine (CAS 132834-58-3) is a chemical compound with the molecular formula C10H12F3N3 and a molecular weight of 231.22 g/mol. IUPAC name: 1-[5-(trifluoromethyl)-2-pyridinyl]piperazine. InChIKey: BNMSJUIMZULLAS-UHFFFAOYSA-N.
| Molecular formula | C10H12F3N3 |
|---|---|
| Molecular weight | 231.22 g/mol |
| IUPAC name | 1-[5-(trifluoromethyl)-2-pyridinyl]piperazine |
| InChIKey | BNMSJUIMZULLAS-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=NC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)