CAS 1187368-66-6 appears in our catalog under these names: 2-Fluoro-n,n-dimethyl-4-nitro-benzamide, 95%, Enzalutamide Impurity 28. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 1g, 5g, on request.
2-fluoro-N,N-dimethyl-4-nitrobenzamide (CAS 1187368-66-6) is a chemical compound with the molecular formula C9H9FN2O3 and a molecular weight of 212.18 g/mol. IUPAC name: 2-fluoro-N,N-dimethyl-4-nitrobenzamide. InChIKey: WEVFQXSTVYAREH-UHFFFAOYSA-N.
| Molecular formula | C9H9FN2O3 |
|---|---|
| Molecular weight | 212.18 g/mol |
| IUPAC name | 2-fluoro-N,N-dimethyl-4-nitrobenzamide |
| InChIKey | WEVFQXSTVYAREH-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=C(C=C(C=C1)[N+](=O)[O-])F |
Computed by PubChem (NCBI)