Products 2226027-82-1
CAS 2226027-82-1 is the registry number for 6-Fluoro-2,2-dimethyl-5-nitro-2,3-dihydrofuro[2,3-b]pyridine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6-fluoro-2,2-dimethyl-5-nitro-3H-furo[2,3-b]pyridine (CAS 2226027-82-1) is a chemical compound with the molecular formula C9H9FN2O3 and a molecular weight of 212.18 g/mol. IUPAC name: 6-fluoro-2,2-dimethyl-5-nitro-3H-furo[2,3-b]pyridine. InChIKey: HRHPXXICTTXACS-UHFFFAOYSA-N.
| Molecular formula | C9H9FN2O3 |
|---|---|
| Molecular weight | 212.18 g/mol |
| IUPAC name | 6-fluoro-2,2-dimethyl-5-nitro-3H-furo[2,3-b]pyridine |
| InChIKey | HRHPXXICTTXACS-UHFFFAOYSA-N |
| SMILES | CC1(CC2=CC(=C(N=C2O1)F)[N+](=O)[O-])C |
Computed by PubChem (NCBI)