CAS 1187385-58-5 appears in our catalog under these names: 1-Bromo-3-chloro-4-(piperidinocarbonyl)benzene, 97%, (4-Bromo-2-chlorophenyl)(piperidin-1-yl)methanone. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 25g, 5g, 10g.
(4-bromo-2-chlorophenyl)-piperidin-1-ylmethanone (CAS 1187385-58-5) is a chemical compound with the molecular formula C12H13BrClNO and a molecular weight of 302.59 g/mol. IUPAC name: (4-bromo-2-chlorophenyl)-piperidin-1-ylmethanone. InChIKey: WGYAAUGIZMSWNE-UHFFFAOYSA-N.
| Molecular formula | C12H13BrClNO |
|---|---|
| Molecular weight | 302.59 g/mol |
| IUPAC name | (4-bromo-2-chlorophenyl)-piperidin-1-ylmethanone |
| InChIKey | WGYAAUGIZMSWNE-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C(=O)C2=C(C=C(C=C2)Br)Cl |
Computed by PubChem (NCBI)