CAS 2270908-12-6 is the registry number for 2-(4-Bromo-2-chloro-phenyl)-n-cyclopropylmethyl-acetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-(4-bromo-2-chlorophenyl)-N-(cyclopropylmethyl)acetamide (CAS 2270908-12-6) is a chemical compound with the molecular formula C12H13BrClNO and a molecular weight of 302.59 g/mol. IUPAC name: 2-(4-bromo-2-chlorophenyl)-N-(cyclopropylmethyl)acetamide. InChIKey: CEDRJHJJHMEDHY-UHFFFAOYSA-N.
| Molecular formula | C12H13BrClNO |
|---|---|
| Molecular weight | 302.59 g/mol |
| IUPAC name | 2-(4-bromo-2-chlorophenyl)-N-(cyclopropylmethyl)acetamide |
| InChIKey | CEDRJHJJHMEDHY-UHFFFAOYSA-N |
| SMILES | C1CC1CNC(=O)CC2=C(C=C(C=C2)Br)Cl |
Computed by PubChem (NCBI)