CAS 1187385-75-6 is the registry number for N-Isopropyl 4-(4-bromopyrazol-1-yl)benzenesulfonamide, 97%. Offered by: Combi-blocks. Available pack sizes: 25g, 100g, 5g, 1g.
4-(4-bromopyrazol-1-yl)-N-propan-2-ylbenzenesulfonamide (CAS 1187385-75-6) is a chemical compound with the molecular formula C12H14BrN3O2S and a molecular weight of 344.23 g/mol. IUPAC name: 4-(4-bromopyrazol-1-yl)-N-propan-2-ylbenzenesulfonamide. InChIKey: XAAHZRFTZSESKU-UHFFFAOYSA-N.
| Molecular formula | C12H14BrN3O2S |
|---|---|
| Molecular weight | 344.23 g/mol |
| IUPAC name | 4-(4-bromopyrazol-1-yl)-N-propan-2-ylbenzenesulfonamide |
| InChIKey | XAAHZRFTZSESKU-UHFFFAOYSA-N |
| SMILES | CC(C)NS(=O)(=O)C1=CC=C(C=C1)N2C=C(C=N2)Br |
Computed by PubChem (NCBI)